C6H5F3O4 — CID 88636175
(E)-2-methyl-3-(2,2,2-trifluoroacetyl)oxyprop-2-enoic acid (PubChem CID 88636175) has the molecular formula C6H5F3O4 and a molecular weight of 198.10 g/mol. Its IUPAC name is (E)-2-methyl-3-(2,2,2-trifluoroacetyl)oxyprop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-(2,2,2-trifluoroacetyl)oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 88636175 |
| Molecular Formula | C6H5F3O4 |
| Molecular Weight | 198.10 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (E)-2-methyl-3-(2,2,2-trifluoroacetyl)oxyprop-2-enoic acid |
| SMILES | C/C(=C\OC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C6H5F3O4/c1-3(4(10)11)2-13-5(12)6(7,8)9/h2H,1H3,(H,10,11)/b3-2+ |
| InChIKey | FYDARQKTAHRMEO-NSCUHMNNSA-N |
| XLogP | 1.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|