About 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate
2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate (PubChem CID 175035441) has the molecular formula C16H25NO6S
and a molecular weight of 359.44 g/mol. Its IUPAC name is 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate |
| PubChem CID | 175035441 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate |
| SMILES | CC(=COS(=O)(=O)CC12CCC(CC1=O)C2(C)C)C(=O)OCCN |
| InChI | InChI=1S/C16H25NO6S/c1-11(14(19)22-7-6-17)9-23-24(20,21)10-16-5-4-12(8-13(16)18)15(16,2)3/h9,12H,4-8,10,17H2,1-3H3 |
| InChIKey | CPHHNALCMSKHJX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate?
The IUPAC name of 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate (CID 175035441) is 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate.
What is the SMILES notation for 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate?
The canonical SMILES for 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate is CC(=COS(=O)(=O)CC12CCC(CC1=O)C2(C)C)C(=O)OCCN.
What is the InChIKey of 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate?
The InChIKey is CPHHNALCMSKHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO6S/c1-11(14(19)22-7-6-17)9-23-24(20,21)10-16-5-4-12(8-13(16)18)15(16,2)3/h9,12H,4-8,10,17H2,1-3H3.
What are the key properties of 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate?
2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate has a molecular weight of 359.44 g/mol, XLogP of 1.13, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 3-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonyloxy]-2-methylprop-2-enoate is sourced from PubChem (CID 175035441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).