C16H25NO7S2 — CID 89376930
2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylsulfamoyl]ethyl 2-methylprop-2-enoate (PubChem CID 89376930) has the molecular formula C16H25NO7S2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylsulfamoyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylsulfamoyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89376930 |
| Molecular Formula | C16H25NO7S2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylsulfamoyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)NS(=O)(=O)CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C16H25NO7S2/c1-11(2)14(19)24-7-8-25(20,21)17-26(22,23)10-16-6-5-12(9-13(16)18)15(16,3)4/h12,17H,1,5-10H2,2-4H3 |
| InChIKey | BKXFHZMSEPFNIZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|