About sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride
sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride (PubChem CID 174663738) has the molecular formula C4H5Cl2NaO4
and a molecular weight of 210.98 g/mol. Its IUPAC name is sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride.
Molecular Properties
| Compound Name | sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride |
| PubChem CID | 174663738 |
| Molecular Formula | C4H5Cl2NaO4 |
| Molecular Weight | 210.98 g/mol |
| Exact Mass | 209.95 |
| IUPAC Name | sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride |
| SMILES | O=C(COC(=O)CCl)OCl.[H-].[Na+] |
| InChI | InChI=1S/C4H4Cl2O4.Na.H/c5-1-3(7)9-2-4(8)10-6;;/h1-2H2;;/q;+1;-1 |
| InChIKey | NIIHSGLZQPXWJE-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.98 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride?
The IUPAC name of sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride (CID 174663738) is sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride.
What is the SMILES notation for sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride?
The canonical SMILES for sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride is O=C(COC(=O)CCl)OCl.[H-].[Na+].
What is the InChIKey of sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride?
The InChIKey is NIIHSGLZQPXWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4Cl2O4.Na.H/c5-1-3(7)9-2-4(8)10-6;;/h1-2H2;;/q;+1;-1.
What are the key properties of sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride?
sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride has a molecular weight of 210.98 g/mol, XLogP of -2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chloro 2-(2-chloroacetyl)oxyacetate;hydride is sourced from PubChem (CID 174663738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).