About chloro 2-chloroethaneperoxoate
chloro 2-chloroethaneperoxoate (PubChem CID 87091274) has the molecular formula C2H2Cl2O3
and a molecular weight of 144.94 g/mol. Its IUPAC name is chloro 2-chloroethaneperoxoate.
Molecular Properties
| Compound Name | chloro 2-chloroethaneperoxoate |
| PubChem CID | 87091274 |
| Molecular Formula | C2H2Cl2O3 |
| Molecular Weight | 144.94 g/mol |
| Exact Mass | 143.94 |
| IUPAC Name | chloro 2-chloroethaneperoxoate |
| SMILES | O=C(CCl)OOCl |
| InChI | InChI=1S/C2H2Cl2O3/c3-1-2(5)6-7-4/h1H2 |
| InChIKey | TZAHPIBFUTWOPV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.94 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze chloro 2-chloroethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 2-chloroethaneperoxoate?
The IUPAC name of chloro 2-chloroethaneperoxoate (CID 87091274) is chloro 2-chloroethaneperoxoate.
What is the SMILES notation for chloro 2-chloroethaneperoxoate?
The canonical SMILES for chloro 2-chloroethaneperoxoate is O=C(CCl)OOCl.
What is the InChIKey of chloro 2-chloroethaneperoxoate?
The InChIKey is TZAHPIBFUTWOPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2Cl2O3/c3-1-2(5)6-7-4/h1H2.
What are the key properties of chloro 2-chloroethaneperoxoate?
chloro 2-chloroethaneperoxoate has a molecular weight of 144.94 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 2-chloroethaneperoxoate is sourced from PubChem (CID 87091274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).