About trimethylplumbyl 2-chloroacetate
trimethylplumbyl 2-chloroacetate (PubChem CID 16683416) has the molecular formula C5H11ClO2Pb
and a molecular weight of 345.79 g/mol. Its IUPAC name is trimethylplumbyl 2-chloroacetate.
Molecular Properties
| Compound Name | trimethylplumbyl 2-chloroacetate |
| PubChem CID | 16683416 |
| Molecular Formula | C5H11ClO2Pb |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | trimethylplumbyl 2-chloroacetate |
| SMILES | C[Pb](C)(C)OC(=O)CCl |
| InChI | InChI=1S/C2H3ClO2.3CH3.Pb/c3-1-2(4)5;;;;/h1H2,(H,4,5);3*1H3;/q;;;;+1/p-1 |
| InChIKey | TUIXDMVCIZNCIB-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trimethylplumbyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylplumbyl 2-chloroacetate?
The IUPAC name of trimethylplumbyl 2-chloroacetate (CID 16683416) is trimethylplumbyl 2-chloroacetate.
What is the SMILES notation for trimethylplumbyl 2-chloroacetate?
The canonical SMILES for trimethylplumbyl 2-chloroacetate is C[Pb](C)(C)OC(=O)CCl.
What is the InChIKey of trimethylplumbyl 2-chloroacetate?
The InChIKey is TUIXDMVCIZNCIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3ClO2.3CH3.Pb/c3-1-2(4)5;;;;/h1H2,(H,4,5);3*1H3;/q;;;;+1/p-1.
What are the key properties of trimethylplumbyl 2-chloroacetate?
trimethylplumbyl 2-chloroacetate has a molecular weight of 345.79 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylplumbyl 2-chloroacetate is sourced from PubChem (CID 16683416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).