About ethylcarbamoyl 2-chloroacetate
ethylcarbamoyl 2-chloroacetate (PubChem CID 91082001) has the molecular formula C5H8ClNO3
and a molecular weight of 165.58 g/mol. Its IUPAC name is ethylcarbamoyl 2-chloroacetate.
Molecular Properties
| Compound Name | ethylcarbamoyl 2-chloroacetate |
| PubChem CID | 91082001 |
| Molecular Formula | C5H8ClNO3 |
| Molecular Weight | 165.58 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | ethylcarbamoyl 2-chloroacetate |
| SMILES | CCNC(=O)OC(=O)CCl |
| InChI | InChI=1S/C5H8ClNO3/c1-2-7-5(9)10-4(8)3-6/h2-3H2,1H3,(H,7,9) |
| InChIKey | GMICUCXHUAVKCG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.58 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethylcarbamoyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylcarbamoyl 2-chloroacetate?
The IUPAC name of ethylcarbamoyl 2-chloroacetate (CID 91082001) is ethylcarbamoyl 2-chloroacetate.
What is the SMILES notation for ethylcarbamoyl 2-chloroacetate?
The canonical SMILES for ethylcarbamoyl 2-chloroacetate is CCNC(=O)OC(=O)CCl.
What is the InChIKey of ethylcarbamoyl 2-chloroacetate?
The InChIKey is GMICUCXHUAVKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClNO3/c1-2-7-5(9)10-4(8)3-6/h2-3H2,1H3,(H,7,9).
What are the key properties of ethylcarbamoyl 2-chloroacetate?
ethylcarbamoyl 2-chloroacetate has a molecular weight of 165.58 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylcarbamoyl 2-chloroacetate is sourced from PubChem (CID 91082001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).