About 2-(2-methylpropylamino)ethyl N-ethylcarbamate
2-(2-methylpropylamino)ethyl N-ethylcarbamate (PubChem CID 138728445) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(2-methylpropylamino)ethyl N-ethylcarbamate.
Molecular Properties
| Compound Name | 2-(2-methylpropylamino)ethyl N-ethylcarbamate |
| PubChem CID | 138728445 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-(2-methylpropylamino)ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCNCC(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-4-11-9(12)13-6-5-10-7-8(2)3/h8,10H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | NUDQLAVANOVOGB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropylamino)ethyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropylamino)ethyl N-ethylcarbamate?
The IUPAC name of 2-(2-methylpropylamino)ethyl N-ethylcarbamate (CID 138728445) is 2-(2-methylpropylamino)ethyl N-ethylcarbamate.
What is the SMILES notation for 2-(2-methylpropylamino)ethyl N-ethylcarbamate?
The canonical SMILES for 2-(2-methylpropylamino)ethyl N-ethylcarbamate is CCNC(=O)OCCNCC(C)C.
What is the InChIKey of 2-(2-methylpropylamino)ethyl N-ethylcarbamate?
The InChIKey is NUDQLAVANOVOGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c1-4-11-9(12)13-6-5-10-7-8(2)3/h8,10H,4-7H2,1-3H3,(H,11,12).
What are the key properties of 2-(2-methylpropylamino)ethyl N-ethylcarbamate?
2-(2-methylpropylamino)ethyl N-ethylcarbamate has a molecular weight of 188.27 g/mol, XLogP of 0.98, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropylamino)ethyl N-ethylcarbamate is sourced from PubChem (CID 138728445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).