C10H4BrF11O4 — CID 89396508
(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-(2-bromoacetyl)oxyacetate (PubChem CID 89396508) has the molecular formula C10H4BrF11O4 and a molecular weight of 477.02 g/mol. Its IUPAC name is (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-(2-bromoacetyl)oxyacetate.
| Compound Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-(2-bromoacetyl)oxyacetate |
|---|---|
| PubChem CID | 89396508 |
| Molecular Formula | C10H4BrF11O4 |
| Molecular Weight | 477.02 g/mol |
| Exact Mass | 475.91 |
| IUPAC Name | (1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl) 2-(2-bromoacetyl)oxyacetate |
| SMILES | O=C(CBr)OCC(=O)OC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H4BrF11O4/c11-1-3(23)25-2-4(24)26-10(22)8(18,19)6(14,15)5(12,13)7(16,17)9(10,20)21/h1-2H2 |
| InChIKey | DQASEGMPIZWIRB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.02 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|