C13H10F14O4 — CID 91694758
[4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-methylbutyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91694758) has the molecular formula C13H10F14O4 and a molecular weight of 496.19 g/mol. Its IUPAC name is [4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-methylbutyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-methylbutyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91694758 |
| Molecular Formula | C13H10F14O4 |
| Molecular Weight | 496.19 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | [4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-methylbutyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(CCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)COC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F14O4/c1-5(4-31-7(29)9(16,17)11(20,21)13(25,26)27)2-3-30-6(28)8(14,15)10(18,19)12(22,23)24/h5H,2-4H2,1H3 |
| InChIKey | DSSSASSXAGZFOT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|