C10H13F7O3 — CID 91691929
1-propoxypropan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91691929) has the molecular formula C10H13F7O3 and a molecular weight of 314.20 g/mol. Its IUPAC name is 1-propoxypropan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 1-propoxypropan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91691929 |
| Molecular Formula | C10H13F7O3 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-propoxypropan-2-yl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCCOCC(C)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7O3/c1-3-4-19-5-6(2)20-7(18)8(11,12)9(13,14)10(15,16)17/h6H,3-5H2,1-2H3 |
| InChIKey | UNPJZAJHYXSFHS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|