C21H32O11S2 — CID 160634838
propan-2-yl (2R)-5-methyl-4-oxo-5-(propanoyloxymethoxycarbonylsulfanyl)-2-(propanoyloxymethoxycarbonylsulfanylmethyl)hexanoate (PubChem CID 160634838) has the molecular formula C21H32O11S2 and a molecular weight of 524.61 g/mol. Its IUPAC name is propan-2-yl (2R)-5-methyl-4-oxo-5-(propanoyloxymethoxycarbonylsulfanyl)-2-(propanoyloxymethoxycarbonylsulfanylmethyl)hexanoate.
| Compound Name | propan-2-yl (2R)-5-methyl-4-oxo-5-(propanoyloxymethoxycarbonylsulfanyl)-2-(propanoyloxymethoxycarbonylsulfanylmethyl)hexanoate |
|---|---|
| PubChem CID | 160634838 |
| Molecular Formula | C21H32O11S2 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | propan-2-yl (2R)-5-methyl-4-oxo-5-(propanoyloxymethoxycarbonylsulfanyl)-2-(propanoyloxymethoxycarbonylsulfanylmethyl)hexanoate |
| SMILES | CCC(=O)OCOC(=O)SC[C@H](CC(=O)C(C)(C)SC(=O)OCOC(=O)CC)C(=O)OC(C)C |
| InChI | InChI=1S/C21H32O11S2/c1-7-16(23)28-11-30-19(26)33-10-14(18(25)32-13(3)4)9-15(22)21(5,6)34-20(27)31-12-29-17(24)8-2/h13-14H,7-12H2,1-6H3/t14-/m0/s1 |
| InChIKey | QMAKCQQHBKIHPN-AWEZNQCLSA-N |
| XLogP | 3.85 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|