C16H26O7S2 — CID 158711526
ethyl (2R)-5-methyl-2-(2-methylpropanoyloxymethoxycarbonylsulfanylmethyl)-4-oxo-5-sulfanylhexanoate (PubChem CID 158711526) has the molecular formula C16H26O7S2 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl (2R)-5-methyl-2-(2-methylpropanoyloxymethoxycarbonylsulfanylmethyl)-4-oxo-5-sulfanylhexanoate.
| Compound Name | ethyl (2R)-5-methyl-2-(2-methylpropanoyloxymethoxycarbonylsulfanylmethyl)-4-oxo-5-sulfanylhexanoate |
|---|---|
| PubChem CID | 158711526 |
| Molecular Formula | C16H26O7S2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | ethyl (2R)-5-methyl-2-(2-methylpropanoyloxymethoxycarbonylsulfanylmethyl)-4-oxo-5-sulfanylhexanoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)OCOC(=O)C(C)C)CC(=O)C(C)(C)S |
| InChI | InChI=1S/C16H26O7S2/c1-6-21-14(19)11(7-12(17)16(4,5)24)8-25-15(20)23-9-22-13(18)10(2)3/h10-11,24H,6-9H2,1-5H3/t11-/m0/s1 |
| InChIKey | PTQXOIJRCAFXEZ-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 95.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|