C28H38O11S2 — CID 159274131
phenyl (2R)-5-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanylmethyl)-5-methyl-4-oxohexanoate (PubChem CID 159274131) has the molecular formula C28H38O11S2 and a molecular weight of 614.74 g/mol. Its IUPAC name is phenyl (2R)-5-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanylmethyl)-5-methyl-4-oxohexanoate.
| Compound Name | phenyl (2R)-5-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanylmethyl)-5-methyl-4-oxohexanoate |
|---|---|
| PubChem CID | 159274131 |
| Molecular Formula | C28H38O11S2 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | phenyl (2R)-5-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanyl)-2-(2,2-dimethylpropanoyloxymethoxycarbonylsulfanylmethyl)-5-methyl-4-oxohexanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)SC[C@H](CC(=O)C(C)(C)SC(=O)OCOC(=O)C(C)(C)C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C28H38O11S2/c1-26(2,3)22(31)35-16-37-24(33)40-15-18(21(30)39-19-12-10-9-11-13-19)14-20(29)28(7,8)41-25(34)38-17-36-23(32)27(4,5)6/h9-13,18H,14-17H2,1-8H3/t18-/m0/s1 |
| InChIKey | KZHDLWCMSQPPCK-SFHVURJKSA-N |
| XLogP | 5.78 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|