C17H23NO6S — CID 142436648
phenyl (2S)-2-amino-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate (PubChem CID 142436648) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is phenyl (2S)-2-amino-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate.
| Compound Name | phenyl (2S)-2-amino-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate |
|---|---|
| PubChem CID | 142436648 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | phenyl (2S)-2-amino-3-methyl-3-(2-methylpropanoyloxymethoxycarbonylsulfanyl)butanoate |
| SMILES | CC(C)C(=O)OCOC(=O)SC(C)(C)[C@@H](N)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H23NO6S/c1-11(2)14(19)22-10-23-16(21)25-17(3,4)13(18)15(20)24-12-8-6-5-7-9-12/h5-9,11,13H,10,18H2,1-4H3/t13-/m0/s1 |
| InChIKey | BNBXNJPTYOLVAU-ZDUSSCGKSA-N |
| XLogP | 2.72 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|