C15H24O6S2 — CID 159855363
[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl 2-methylpropanoate (PubChem CID 159855363) has the molecular formula C15H24O6S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is [(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl 2-methylpropanoate.
| Compound Name | [(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 159855363 |
| Molecular Formula | C15H24O6S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl 2-methylpropanoate |
| SMILES | CC(=O)C(CSC(=O)OCOC(=O)C(C)C)CC(=O)C(C)(C)S |
| InChI | InChI=1S/C15H24O6S2/c1-9(2)13(18)20-8-21-14(19)23-7-11(10(3)16)6-12(17)15(4,5)22/h9,11,22H,6-8H2,1-5H3 |
| InChIKey | GVEKFGQZFYMGET-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|