About S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate
S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate (PubChem CID 161241418) has the molecular formula C14H18O4S2
and a molecular weight of 314.43 g/mol. Its IUPAC name is S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate.
Molecular Properties
| Compound Name | S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate |
| PubChem CID | 161241418 |
| Molecular Formula | C14H18O4S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate |
| SMILES | CC(=O)[C@H](CSC(=O)c1ccco1)CC(=O)C(C)(C)S |
| InChI | InChI=1S/C14H18O4S2/c1-9(15)10(7-12(16)14(2,3)19)8-20-13(17)11-5-4-6-18-11/h4-6,10,19H,7-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | ASELALJTRIQKFG-JTQLQIEISA-N |
| XLogP | 3.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate?
The IUPAC name of S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate (CID 161241418) is S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate.
What is the SMILES notation for S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate?
The canonical SMILES for S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate is CC(=O)[C@H](CSC(=O)c1ccco1)CC(=O)C(C)(C)S.
What is the InChIKey of S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate?
The InChIKey is ASELALJTRIQKFG-JTQLQIEISA-N. The full InChI is InChI=1S/C14H18O4S2/c1-9(15)10(7-12(16)14(2,3)19)8-20-13(17)11-5-4-6-18-11/h4-6,10,19H,7-8H2,1-3H3/t10-/m0/s1.
What are the key properties of S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate?
S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate has a molecular weight of 314.43 g/mol, XLogP of 3.03, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl] furan-2-carbothioate is sourced from PubChem (CID 161241418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).