C9H11NO4 — CID 174420359
N-(2-hydroxy-2-methylpropanoyl)furan-2-carboxamide (PubChem CID 174420359) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropanoyl)furan-2-carboxamide.
| Compound Name | N-(2-hydroxy-2-methylpropanoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 174420359 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | N-(2-hydroxy-2-methylpropanoyl)furan-2-carboxamide |
| SMILES | CC(C)(O)C(=O)NC(=O)c1ccco1 |
| InChI | InChI=1S/C9H11NO4/c1-9(2,13)8(12)10-7(11)6-4-3-5-14-6/h3-5,13H,1-2H3,(H,10,11,12) |
| InChIKey | HBHYVMLHVRNVOG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |