C8H5F6NO3 — CID 21204899
N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)furan-2-carboxamide (PubChem CID 21204899) has the molecular formula C8H5F6NO3 and a molecular weight of 277.12 g/mol. Its IUPAC name is N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)furan-2-carboxamide.
| Compound Name | N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21204899 |
| Molecular Formula | C8H5F6NO3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | N-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)furan-2-carboxamide |
| SMILES | O=C(NC(O)(C(F)(F)F)C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C8H5F6NO3/c9-7(10,11)6(17,8(12,13)14)15-5(16)4-2-1-3-18-4/h1-3,17H,(H,15,16) |
| InChIKey | RRFBJYLEBZAYOR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|