C14H11F6N3O2 — CID 658458
N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-2-ylmethylamino)propan-2-yl]furan-2-carboxamide (PubChem CID 658458) has the molecular formula C14H11F6N3O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-2-ylmethylamino)propan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-2-ylmethylamino)propan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 658458 |
| Molecular Formula | C14H11F6N3O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(pyridin-2-ylmethylamino)propan-2-yl]furan-2-carboxamide |
| SMILES | O=C(NC(NCc1ccccn1)(C(F)(F)F)C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C14H11F6N3O2/c15-13(16,17)12(14(18,19)20,22-8-9-4-1-2-6-21-9)23-11(24)10-5-3-7-25-10/h1-7,22H,8H2,(H,23,24) |
| InChIKey | KWQYFGSNZNSTPQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|