C15H14F3N3O4 — CID 3708601
methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(6-methyl-2-pyridinyl)amino]propanoate (PubChem CID 3708601) has the molecular formula C15H14F3N3O4 and a molecular weight of 357.29 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(6-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(6-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 3708601 |
| Molecular Formula | C15H14F3N3O4 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(6-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)c1ccco1)(Nc1cccc(C)n1)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O4/c1-9-5-3-7-11(19-9)20-14(13(23)24-2,15(16,17)18)21-12(22)10-6-4-8-25-10/h3-8H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | PZFIOFQRZIZHOI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|