C16H13Cl2F3N2O4 — CID 2817935
ethyl 2-(3,4-dichloroanilino)-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate (PubChem CID 2817935) has the molecular formula C16H13Cl2F3N2O4 and a molecular weight of 425.19 g/mol. Its IUPAC name is ethyl 2-(3,4-dichloroanilino)-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate.
| Compound Name | ethyl 2-(3,4-dichloroanilino)-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 2817935 |
| Molecular Formula | C16H13Cl2F3N2O4 |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | ethyl 2-(3,4-dichloroanilino)-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccco1)(Nc1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C16H13Cl2F3N2O4/c1-2-26-14(25)15(16(19,20)21,23-13(24)12-4-3-7-27-12)22-9-5-6-10(17)11(18)8-9/h3-8,22H,2H2,1H3,(H,23,24) |
| InChIKey | KVZGGZZXZSVRRB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|