C16H13ClF3N3O3 — CID 3337235
methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate (PubChem CID 3337235) has the molecular formula C16H13ClF3N3O3 and a molecular weight of 387.75 g/mol. Its IUPAC name is methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate.
| Compound Name | methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 3337235 |
| Molecular Formula | C16H13ClF3N3O3 |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | methyl 2-[(3-chlorobenzoyl)amino]-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate |
| SMILES | COC(=O)C(NC(=O)c1cccc(Cl)c1)(Nc1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C16H13ClF3N3O3/c1-26-14(25)15(16(18,19)20,22-12-7-2-3-8-21-12)23-13(24)10-5-4-6-11(17)9-10/h2-9H,1H3,(H,21,22)(H,23,24) |
| InChIKey | CSAJBMQQUNGNHV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|