C18H18F3N3O4 — CID 4671461
methyl 3,3,3-trifluoro-2-[(2-methoxybenzoyl)amino]-2-[(4-methyl-2-pyridinyl)amino]propanoate (PubChem CID 4671461) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-[(2-methoxybenzoyl)amino]-2-[(4-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-[(2-methoxybenzoyl)amino]-2-[(4-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 4671461 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-[(2-methoxybenzoyl)amino]-2-[(4-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1OC)(Nc1cc(C)ccn1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O4/c1-11-8-9-22-14(10-11)23-17(16(26)28-3,18(19,20)21)24-15(25)12-6-4-5-7-13(12)27-2/h4-10H,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | LGZVXRSPODHNEP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|