C14H22O6S2 — CID 159855362
[(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl propanoate (PubChem CID 159855362) has the molecular formula C14H22O6S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl propanoate.
| Compound Name | [(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl propanoate |
|---|---|
| PubChem CID | 159855362 |
| Molecular Formula | C14H22O6S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(2R)-2-acetyl-5-methyl-4-oxo-5-sulfanylhexyl]sulfanylcarbonyloxymethyl propanoate |
| SMILES | CCC(=O)OCOC(=O)SCC(CC(=O)C(C)(C)S)C(C)=O |
| InChI | InChI=1S/C14H22O6S2/c1-5-12(17)19-8-20-13(18)22-7-10(9(2)15)6-11(16)14(3,4)21/h10,21H,5-8H2,1-4H3 |
| InChIKey | GSSODJIXAJETNE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|