C24H28ClN3O7S2 — CID 20768093
4-nitrooxybutyl 2-acetamido-3-[3-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzoyl]sulfanylpropanoate (PubChem CID 20768093) has the molecular formula C24H28ClN3O7S2 and a molecular weight of 570.09 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-acetamido-3-[3-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzoyl]sulfanylpropanoate.
| Compound Name | 4-nitrooxybutyl 2-acetamido-3-[3-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzoyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 20768093 |
| Molecular Formula | C24H28ClN3O7S2 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | 4-nitrooxybutyl 2-acetamido-3-[3-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzoyl]sulfanylpropanoate |
| SMILES | CC(=O)NC(CSC(=O)c1cccc(Cl)c1CN1CCc2sccc2C1)C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C24H28ClN3O7S2/c1-16(29)26-21(23(30)34-10-2-3-11-35-28(32)33)15-37-24(31)18-5-4-6-20(25)19(18)14-27-9-7-22-17(13-27)8-12-36-22/h4-6,8,12,21H,2-3,7,9-11,13-15H2,1H3,(H,26,29) |
| InChIKey | TULJRECTINBOPG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|