C16H16ClN3O2S — CID 18138052
2-chloro-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide (PubChem CID 18138052) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-chloro-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 18138052 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-chloro-N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]benzohydrazide |
| SMILES | O=C(CN1CCc2sccc2C1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClN3O2S/c17-13-4-2-1-3-12(13)16(22)19-18-15(21)10-20-7-5-14-11(9-20)6-8-23-14/h1-4,6,8H,5,7,9-10H2,(H,18,21)(H,19,22) |
| InChIKey | XNTYEFUMCSJZTF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|