C15H17N3O2S2 — CID 71882017
N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]-5-methylthiophene-2-carbohydrazide (PubChem CID 71882017) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]-5-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]-5-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 71882017 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N'-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetyl]-5-methylthiophene-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CN2CCc3sccc3C2)s1 |
| InChI | InChI=1S/C15H17N3O2S2/c1-10-2-3-13(22-10)15(20)17-16-14(19)9-18-6-4-12-11(8-18)5-7-21-12/h2-3,5,7H,4,6,8-9H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | HHEZFGYJUJUXTM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|