C19H25N3OS — CID 18137887
N-[4-(diethylamino)phenyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide (PubChem CID 18137887) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 18137887 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CN2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C19H25N3OS/c1-3-22(4-2)17-7-5-16(6-8-17)20-19(23)14-21-11-9-18-15(13-21)10-12-24-18/h5-8,10,12H,3-4,9,11,13-14H2,1-2H3,(H,20,23) |
| InChIKey | BUBUKEDCQQVCPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|