C32H44N2O12 — CID 160627730
4-nitrooxybutyl 3-methoxy-4-propan-2-ylbenzoate;4-nitrooxybutyl (E)-3-(3-methoxy-4-propan-2-ylphenyl)prop-2-enoate (PubChem CID 160627730) has the molecular formula C32H44N2O12 and a molecular weight of 648.71 g/mol. Its IUPAC name is 4-nitrooxybutyl 3-methoxy-4-propan-2-ylbenzoate;4-nitrooxybutyl (E)-3-(3-methoxy-4-propan-2-ylphenyl)prop-2-enoate.
| Compound Name | 4-nitrooxybutyl 3-methoxy-4-propan-2-ylbenzoate;4-nitrooxybutyl (E)-3-(3-methoxy-4-propan-2-ylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 160627730 |
| Molecular Formula | C32H44N2O12 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | 4-nitrooxybutyl 3-methoxy-4-propan-2-ylbenzoate;4-nitrooxybutyl (E)-3-(3-methoxy-4-propan-2-ylphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCO[N+](=O)[O-])ccc1C(C)C.COc1cc(C(=O)OCCCCO[N+](=O)[O-])ccc1C(C)C |
| InChI | InChI=1S/C17H23NO6.C15H21NO6/c1-13(2)15-8-6-14(12-16(15)22-3)7-9-17(19)23-10-4-5-11-24-18(20)21;1-11(2)13-7-6-12(10-14(13)20-3)15(17)21-8-4-5-9-22-16(18)19/h6-9,12-13H,4-5,10-11H2,1-3H3;6-7,10-11H,4-5,8-9H2,1-3H3/b9-7+; |
| InChIKey | RHNIKCBDOGTXTF-BXTVWIJMSA-N |
| XLogP | 6.33 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|