About 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 59407362) has the molecular formula C12H13NO6
and a molecular weight of 267.24 g/mol. Its IUPAC name is 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| PubChem CID | 59407362 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO6/c14-11-5-2-10(3-6-11)4-7-12(15)18-8-1-9-19-13(16)17/h2-7,14H,1,8-9H2/b7-4+ |
| InChIKey | VHEOQGHXWRITKW-QPJJXVBHSA-N |
| XLogP | 1.55 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate?
The IUPAC name of 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (CID 59407362) is 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
What is the SMILES notation for 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate?
The canonical SMILES for 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate is O=C(/C=C/c1ccc(O)cc1)OCCCO[N+](=O)[O-].
What is the InChIKey of 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate?
The InChIKey is VHEOQGHXWRITKW-QPJJXVBHSA-N. The full InChI is InChI=1S/C12H13NO6/c14-11-5-2-10(3-6-11)4-7-12(15)18-8-1-9-19-13(16)17/h2-7,14H,1,8-9H2/b7-4+.
What are the key properties of 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate?
3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate has a molecular weight of 267.24 g/mol, XLogP of 1.55, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrooxypropyl (E)-3-(4-hydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 59407362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).