C27H32N2O9 — CID 142076249
6-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]oxyhexyl 3-nitro-5-nitrosobenzoate (PubChem CID 142076249) has the molecular formula C27H32N2O9 and a molecular weight of 528.56 g/mol. Its IUPAC name is 6-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]oxyhexyl 3-nitro-5-nitrosobenzoate.
| Compound Name | 6-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]oxyhexyl 3-nitro-5-nitrosobenzoate |
|---|---|
| PubChem CID | 142076249 |
| Molecular Formula | C27H32N2O9 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 6-[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]oxyhexyl 3-nitro-5-nitrosobenzoate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)OCCCCCCOC(=O)c2cc(N=O)cc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C27H32N2O9/c1-3-4-13-36-24-11-9-20(16-25(24)35-2)10-12-26(30)37-14-7-5-6-8-15-38-27(31)21-17-22(28-32)19-23(18-21)29(33)34/h9-12,16-19H,3-8,13-15H2,1-2H3/b12-10+ |
| InChIKey | IGGZITZICPSMQL-ZRDIBKRKSA-N |
| XLogP | 6.15 |
| TPSA | 143.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|