C23H25N5O9S3 — CID 143690745
[4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;5-amino-3H-1,3,4-thiadiazole-2-thione;3-sulfanylbenzoic acid (PubChem CID 143690745) has the molecular formula C23H25N5O9S3 and a molecular weight of 611.68 g/mol. Its IUPAC name is [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;5-amino-3H-1,3,4-thiadiazole-2-thione;3-sulfanylbenzoic acid.
| Compound Name | [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;5-amino-3H-1,3,4-thiadiazole-2-thione;3-sulfanylbenzoic acid |
|---|---|
| PubChem CID | 143690745 |
| Molecular Formula | C23H25N5O9S3 |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;5-amino-3H-1,3,4-thiadiazole-2-thione;3-sulfanylbenzoic acid |
| SMILES | COc1cc(/C=C/C(N)=O)ccc1OC(=O)CCCO[N+](=O)[O-].Nc1n[nH]c(=S)s1.O=C(O)c1cccc(S)c1 |
| InChI | InChI=1S/C14H16N2O7.C7H6O2S.C2H3N3S2/c1-21-12-9-10(5-7-13(15)17)4-6-11(12)23-14(18)3-2-8-22-16(19)20;8-7(9)5-2-1-3-6(10)4-5;3-1-4-5-2(6)7-1/h4-7,9H,2-3,8H2,1H3,(H2,15,17);1-4,10H,(H,8,9);(H2,3,4)(H,5,6)/b7-5+;; |
| InChIKey | RTQGOPZQCDBBDX-WVKUUHRJSA-N |
| XLogP | 3.54 |
| TPSA | 222.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|