C22H26N2O9S — CID 143690898
[4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;formic acid;4-methylbenzenethiol (PubChem CID 143690898) has the molecular formula C22H26N2O9S and a molecular weight of 494.52 g/mol. Its IUPAC name is [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;formic acid;4-methylbenzenethiol.
| Compound Name | [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;formic acid;4-methylbenzenethiol |
|---|---|
| PubChem CID | 143690898 |
| Molecular Formula | C22H26N2O9S |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | [4-[(E)-3-amino-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate;formic acid;4-methylbenzenethiol |
| SMILES | COc1cc(/C=C/C(N)=O)ccc1OC(=O)CCCO[N+](=O)[O-].Cc1ccc(S)cc1.O=CO |
| InChI | InChI=1S/C14H16N2O7.C7H8S.CH2O2/c1-21-12-9-10(5-7-13(15)17)4-6-11(12)23-14(18)3-2-8-22-16(19)20;1-6-2-4-7(8)5-3-6;2-1-3/h4-7,9H,2-3,8H2,1H3,(H2,15,17);2-5,8H,1H3;1H,(H,2,3)/b7-5+;; |
| InChIKey | JWAVNZABCHVRAC-WVKUUHRJSA-N |
| XLogP | 3.07 |
| TPSA | 168.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|