C23H28N4O9S3 — CID 143699342
[4-[(E)-3-[(6-aminosulfanyl-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl)-ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate (PubChem CID 143699342) has the molecular formula C23H28N4O9S3 and a molecular weight of 600.70 g/mol. Its IUPAC name is [4-[(E)-3-[(6-aminosulfanyl-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl)-ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate.
| Compound Name | [4-[(E)-3-[(6-aminosulfanyl-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl)-ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 143699342 |
| Molecular Formula | C23H28N4O9S3 |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | [4-[(E)-3-[(6-aminosulfanyl-2-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl)-ethylamino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-nitrooxybutanoate |
| SMILES | CCN(C(=O)/C=C/c1ccc(OC(=O)CCCO[N+](=O)[O-])c(OC)c1)C1CN(C)S(=O)(=O)c2sc(SN)cc21 |
| InChI | InChI=1S/C23H28N4O9S3/c1-4-26(17-14-25(2)39(32,33)23-16(17)13-22(37-23)38-24)20(28)10-8-15-7-9-18(19(12-15)34-3)36-21(29)6-5-11-35-27(30)31/h7-10,12-13,17H,4-6,11,14,24H2,1-3H3/b10-8+ |
| InChIKey | PTJPCMFERBPJPI-CSKARUKUSA-N |
| XLogP | 2.85 |
| TPSA | 171.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|