C20H26N4O8S3 — CID 143699414
[2-(nitrooxymethyl)phenyl] N-[6-aminosulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]-N-ethylcarbamate (PubChem CID 143699414) has the molecular formula C20H26N4O8S3 and a molecular weight of 546.65 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl] N-[6-aminosulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]-N-ethylcarbamate.
| Compound Name | [2-(nitrooxymethyl)phenyl] N-[6-aminosulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 143699414 |
| Molecular Formula | C20H26N4O8S3 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl] N-[6-aminosulfanyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)Oc1ccccc1CO[N+](=O)[O-])C1CN(CCCOC)S(=O)(=O)c2sc(SN)cc21 |
| InChI | InChI=1S/C20H26N4O8S3/c1-3-23(20(25)32-17-8-5-4-7-14(17)13-31-24(26)27)16-12-22(9-6-10-30-2)35(28,29)19-15(16)11-18(33-19)34-21/h4-5,7-8,11,16H,3,6,9-10,12-13,21H2,1-2H3 |
| InChIKey | LDHDEGROBGKSNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 154.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|