C20H26N4O7S3 — CID 143699432
[4-[[4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanylcarbamoyl]phenyl]methyl nitrate (PubChem CID 143699432) has the molecular formula C20H26N4O7S3 and a molecular weight of 530.65 g/mol. Its IUPAC name is [4-[[4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanylcarbamoyl]phenyl]methyl nitrate.
| Compound Name | [4-[[4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanylcarbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 143699432 |
| Molecular Formula | C20H26N4O7S3 |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | [4-[[4-(ethylamino)-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-6-yl]sulfanylcarbamoyl]phenyl]methyl nitrate |
| SMILES | CCNC1CN(CCCOC)S(=O)(=O)c2sc(SNC(=O)c3ccc(CO[N+](=O)[O-])cc3)cc21 |
| InChI | InChI=1S/C20H26N4O7S3/c1-3-21-17-12-23(9-4-10-30-2)34(28,29)20-16(17)11-18(32-20)33-22-19(25)15-7-5-14(6-8-15)13-31-24(26)27/h5-8,11,17,21H,3-4,9-10,12-13H2,1-2H3,(H,22,25) |
| InChIKey | IYCBMXFYOMUCNG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|