C13H21N3O6S3 — CID 54250372
3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl acetate (PubChem CID 54250372) has the molecular formula C13H21N3O6S3 and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl acetate.
| Compound Name | 3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl acetate |
|---|---|
| PubChem CID | 54250372 |
| Molecular Formula | C13H21N3O6S3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl acetate |
| SMILES | CCN[C@H]1CN(CCCOC(C)=O)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C13H21N3O6S3/c1-3-15-11-8-16(5-4-6-22-9(2)17)25(20,21)13-10(11)7-12(23-13)24(14,18)19/h7,11,15H,3-6,8H2,1-2H3,(H2,14,18,19)/t11-/m0/s1 |
| InChIKey | QWHWMCIWJVNUDI-NSHDSACASA-N |
| XLogP | 0.00 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|