C19H28ClN3O4S3 — CID 22901999
1,1-dioxo-2-(4-phenylbutyl)-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;hydrochloride (PubChem CID 22901999) has the molecular formula C19H28ClN3O4S3 and a molecular weight of 494.10 g/mol. Its IUPAC name is 1,1-dioxo-2-(4-phenylbutyl)-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;hydrochloride.
| Compound Name | 1,1-dioxo-2-(4-phenylbutyl)-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22901999 |
| Molecular Formula | C19H28ClN3O4S3 |
| Molecular Weight | 494.10 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 1,1-dioxo-2-(4-phenylbutyl)-4-(propylamino)-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide;hydrochloride |
| SMILES | CCCNC1CN(CCCCc2ccccc2)S(=O)(=O)c2sc(S(N)(=O)=O)cc21.Cl |
| InChI | InChI=1S/C19H27N3O4S3.ClH/c1-2-11-21-17-14-22(12-7-6-10-15-8-4-3-5-9-15)29(25,26)19-16(17)13-18(27-19)28(20,23)24;/h3-5,8-9,13,17,21H,2,6-7,10-12,14H2,1H3,(H2,20,23,24);1H |
| InChIKey | DJRQXIVJVIMIRK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.10 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|