C12H16N2O5S3 — CID 118087538
(4R)-4-ethynyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 118087538) has the molecular formula C12H16N2O5S3 and a molecular weight of 364.47 g/mol. Its IUPAC name is (4R)-4-ethynyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-ethynyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 118087538 |
| Molecular Formula | C12H16N2O5S3 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (4R)-4-ethynyl-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | C#C[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C12H16N2O5S3/c1-3-9-8-14(5-4-6-19-2)22(17,18)12-10(9)7-11(20-12)21(13,15)16/h1,7,9H,4-6,8H2,2H3,(H2,13,15,16)/t9-/m0/s1 |
| InChIKey | ZOMBZCFJBAXSBG-VIFPVBQESA-N |
| XLogP | 0.15 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|