C13H21N3O6S3 — CID 140888330
2-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]propanamide (PubChem CID 140888330) has the molecular formula C13H21N3O6S3 and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]propanamide.
| Compound Name | 2-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]propanamide |
|---|---|
| PubChem CID | 140888330 |
| Molecular Formula | C13H21N3O6S3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]propanamide |
| SMILES | COCCCN1C[C@H](C(C)C(N)=O)c2cc(S(N)(=O)=O)sc2S1(=O)=O |
| InChI | InChI=1S/C13H21N3O6S3/c1-8(12(14)17)10-7-16(4-3-5-22-2)25(20,21)13-9(10)6-11(23-13)24(15,18)19/h6,8,10H,3-5,7H2,1-2H3,(H2,14,17)(H2,15,18,19)/t8?,10-/m1/s1 |
| InChIKey | GURHWQINCSUAMR-LHIURRSHSA-N |
| XLogP | -0.36 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|