C13H21BrN2O4S3 — CID 67693138
6-(3-bromopropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 67693138) has the molecular formula C13H21BrN2O4S3 and a molecular weight of 445.43 g/mol. Its IUPAC name is 6-(3-bromopropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 6-(3-bromopropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 67693138 |
| Molecular Formula | C13H21BrN2O4S3 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 6-(3-bromopropyl)-7,7-dioxo-4-(propylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCCNC1CC(CCCBr)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C13H21BrN2O4S3/c1-2-6-16-11-7-9(4-3-5-14)22(17,18)13-10(11)8-12(21-13)23(15,19)20/h8-9,11,16H,2-7H2,1H3,(H2,15,19,20) |
| InChIKey | PMVVZCCBAZRBNZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|