C14H20N2O8S3 — CID 171380830
(Z)-but-2-enedioic acid;(4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 171380830) has the molecular formula C14H20N2O8S3 and a molecular weight of 440.52 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | (Z)-but-2-enedioic acid;(4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 171380830 |
| Molecular Formula | C14H20N2O8S3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (Z)-but-2-enedioic acid;(4R,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCN[C@@H]1C[C@@H](C)S(=O)(=O)c2sc(S(N)(=O)=O)cc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C10H16N2O4S3.C4H4O4/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16;5-3(6)1-2-4(7)8/h5-6,8,12H,3-4H2,1-2H3,(H2,11,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1-/t6-,8-;/m1./s1 |
| InChIKey | BWNVRFMDHAMJFT-OQPYJVJISA-N |
| XLogP | 0.32 |
| TPSA | 180.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|