C10H16N2O9S3 — CID 90866714
6-methyl-7,7-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 90866714) has the molecular formula C10H16N2O9S3 and a molecular weight of 404.44 g/mol. Its IUPAC name is 6-methyl-7,7-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 6-methyl-7,7-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 90866714 |
| Molecular Formula | C10H16N2O9S3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 6-methyl-7,7-dioxo-4-(1,1,2,2,2-pentahydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CC1CC(NC(O)(O)C(O)(O)O)c2cc(S(N)(=O)=O)sc2S1(=O)=O |
| InChI | InChI=1S/C10H16N2O9S3/c1-4-2-6(12-9(13,14)10(15,16)17)5-3-7(24(11,20)21)22-8(5)23(4,18)19/h3-4,6,12-17H,2H2,1H3,(H2,11,20,21) |
| InChIKey | UDJNYASFLVLOHF-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 207.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|