C11H18N2O10S3 — CID 90899109
7,7-dioxo-6-(2,2,2-trihydroxyethyl)-4-(2,2,2-trihydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 90899109) has the molecular formula C11H18N2O10S3 and a molecular weight of 434.47 g/mol. Its IUPAC name is 7,7-dioxo-6-(2,2,2-trihydroxyethyl)-4-(2,2,2-trihydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 7,7-dioxo-6-(2,2,2-trihydroxyethyl)-4-(2,2,2-trihydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 90899109 |
| Molecular Formula | C11H18N2O10S3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | 7,7-dioxo-6-(2,2,2-trihydroxyethyl)-4-(2,2,2-trihydroxyethylamino)-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(s1)S(=O)(=O)C(CC(O)(O)O)CC2NCC(O)(O)O |
| InChI | InChI=1S/C11H18N2O10S3/c12-26(22,23)8-2-6-7(13-4-11(17,18)19)1-5(3-10(14,15)16)25(20,21)9(6)24-8/h2,5,7,13-19H,1,3-4H2,(H2,12,22,23) |
| InChIKey | CCPLWYCMUDEJCL-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 227.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|