C11H17N3O7S3 — CID 25174192
2-[(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]ethyl nitrate (PubChem CID 25174192) has the molecular formula C11H17N3O7S3 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]ethyl nitrate.
| Compound Name | 2-[(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]ethyl nitrate |
|---|---|
| PubChem CID | 25174192 |
| Molecular Formula | C11H17N3O7S3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]ethyl nitrate |
| SMILES | CCN[C@H]1C[C@H](CCO[N+](=O)[O-])S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C11H17N3O7S3/c1-2-13-9-5-7(3-4-21-14(15)16)23(17,18)11-8(9)6-10(22-11)24(12,19)20/h6-7,9,13H,2-5H2,1H3,(H2,12,19,20)/t7-,9-/m0/s1 |
| InChIKey | UGBCNBXMWQAAOR-CBAPKCEASA-N |
| XLogP | 0.19 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|