C17H24N2O8S3 — CID 158809440
[5-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]-2,5-dioxopentyl] acetate (PubChem CID 158809440) has the molecular formula C17H24N2O8S3 and a molecular weight of 480.59 g/mol. Its IUPAC name is [5-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]-2,5-dioxopentyl] acetate.
| Compound Name | [5-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]-2,5-dioxopentyl] acetate |
|---|---|
| PubChem CID | 158809440 |
| Molecular Formula | C17H24N2O8S3 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [5-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonylamino]-2,5-dioxopentyl] acetate |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)CCC(=O)COC(C)=O)cc21 |
| InChI | InChI=1S/C17H24N2O8S3/c1-4-18-14-7-10(2)29(23,24)17-13(14)8-16(28-17)30(25,26)19-15(22)6-5-12(21)9-27-11(3)20/h8,10,14,18H,4-7,9H2,1-3H3,(H,19,22)/t10-,14-/m0/s1 |
| InChIKey | IUMKSHFKXGLSPF-HZMBPMFUSA-N |
| XLogP | 0.68 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |