C13H22N2O3S2 — CID 134220063
(4R)-N-ethyl-2-(3-methoxypropyl)-6-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-amine (PubChem CID 134220063) has the molecular formula C13H22N2O3S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4R)-N-ethyl-2-(3-methoxypropyl)-6-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-amine.
| Compound Name | (4R)-N-ethyl-2-(3-methoxypropyl)-6-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-amine |
|---|---|
| PubChem CID | 134220063 |
| Molecular Formula | C13H22N2O3S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (4R)-N-ethyl-2-(3-methoxypropyl)-6-methyl-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazin-4-amine |
| SMILES | CCN[C@H]1CN(CCCOC)S(=O)(=O)c2sc(C)cc21 |
| InChI | InChI=1S/C13H22N2O3S2/c1-4-14-12-9-15(6-5-7-18-3)20(16,17)13-11(12)8-10(2)19-13/h8,12,14H,4-7,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | YZOQZHMHEFLIAO-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|