C19H23N3O7S3 — CID 143699448
[2-(nitrooxymethyl)phenyl]methyl N-[[4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfanyl]carbamate (PubChem CID 143699448) has the molecular formula C19H23N3O7S3 and a molecular weight of 501.61 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl]methyl N-[[4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfanyl]carbamate.
| Compound Name | [2-(nitrooxymethyl)phenyl]methyl N-[[4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfanyl]carbamate |
|---|---|
| PubChem CID | 143699448 |
| Molecular Formula | C19H23N3O7S3 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl]methyl N-[[4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfanyl]carbamate |
| SMILES | CCNC1CC(C)S(=O)(=O)c2sc(SNC(=O)OCc3ccccc3CO[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H23N3O7S3/c1-3-20-16-8-12(2)32(26,27)18-15(16)9-17(30-18)31-21-19(23)28-10-13-6-4-5-7-14(13)11-29-22(24)25/h4-7,9,12,16,20H,3,8,10-11H2,1-2H3,(H,21,23) |
| InChIKey | NGQUDGCLFYMARI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|