C32H42N2O7S3Si — CID 153317875
(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-N-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonyl]-2-methyl-3-oxopentanamide (PubChem CID 153317875) has the molecular formula C32H42N2O7S3Si and a molecular weight of 690.98 g/mol. Its IUPAC name is (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-N-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonyl]-2-methyl-3-oxopentanamide.
| Compound Name | (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-N-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonyl]-2-methyl-3-oxopentanamide |
|---|---|
| PubChem CID | 153317875 |
| Molecular Formula | C32H42N2O7S3Si |
| Molecular Weight | 690.98 g/mol |
| Exact Mass | 690.19 |
| IUPAC Name | (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-N-[[(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-yl]sulfonyl]-2-methyl-3-oxopentanamide |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)c2sc(S(=O)(=O)NC(=O)[C@@H](C)C(=O)[C@H](C)O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc21 |
| InChI | InChI=1S/C32H42N2O7S3Si/c1-8-33-27-19-21(2)43(37,38)31-26(27)20-28(42-31)44(39,40)34-30(36)22(3)29(35)23(4)41-45(32(5,6)7,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18,20-23,27,33H,8,19H2,1-7H3,(H,34,36)/t21-,22-,23-,27-/m0/s1 |
| InChIKey | LJZDNKVPXWRDGF-FAWUNYRSSA-N |
| XLogP | 3.94 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.98 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|